C20H23NO7 — CID 4839256
3-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoic acid (PubChem CID 4839256) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is 3-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 4839256 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoic acid |
| SMILES | Cc1cc(=O)oc2c3c(cc(OCC(=O)NCCC(=O)O)c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C20H23NO7/c1-11-8-17(25)27-19-12-4-6-20(2,3)28-13(12)9-14(18(11)19)26-10-15(22)21-7-5-16(23)24/h8-9H,4-7,10H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | DJUKULJGSZMWTE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|