C20H22NO7- — CID 7095210
(2S)-2-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoate (PubChem CID 7095210) has the molecular formula C20H22NO7- and a molecular weight of 388.40 g/mol. Its IUPAC name is (2S)-2-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoate.
| Compound Name | (2S)-2-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 7095210 |
| Molecular Formula | C20H22NO7- |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-2-[[2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]propanoate |
| SMILES | Cc1cc(=O)oc2c3c(cc(OCC(=O)N[C@@H](C)C(=O)[O-])c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C20H23NO7/c1-10-7-16(23)27-18-12-5-6-20(3,4)28-13(12)8-14(17(10)18)26-9-15(22)21-11(2)19(24)25/h7-8,11H,5-6,9H2,1-4H3,(H,21,22)(H,24,25)/p-1/t11-/m0/s1 |
| InChIKey | IGGKDNNZVYVMSK-NSHDSACASA-M |
| XLogP | 0.84 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|