C25H31NO7 — CID 73256672
2-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]-3-methylpentanoic acid (PubChem CID 73256672) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is 2-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 73256672 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)COc1cc2c(c3oc(=O)c4c(c13)CCC4)CCC(C)(C)O2)C(=O)O |
| InChI | InChI=1S/C25H31NO7/c1-5-13(2)21(23(28)29)26-19(27)12-31-18-11-17-16(9-10-25(3,4)33-17)22-20(18)14-7-6-8-15(14)24(30)32-22/h11,13,21H,5-10,12H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | WWWHAORSCIZWGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|