C29H40N2O7 — CID 73256791
4-methyl-N-(oxolan-2-ylmethyl)-2-[[2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]pentanamide (PubChem CID 73256791) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is 4-methyl-N-(oxolan-2-ylmethyl)-2-[[2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]pentanamide.
| Compound Name | 4-methyl-N-(oxolan-2-ylmethyl)-2-[[2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 73256791 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 4-methyl-N-(oxolan-2-ylmethyl)-2-[[2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]amino]pentanamide |
| SMILES | Cc1c(C)c2c(OCC(=O)NC(CC(C)C)C(=O)NCC3CCCO3)cc3c(c2oc1=O)CCC(C)(C)O3 |
| InChI | InChI=1S/C29H40N2O7/c1-16(2)12-21(27(33)30-14-19-8-7-11-35-19)31-24(32)15-36-23-13-22-20(9-10-29(5,6)38-22)26-25(23)17(3)18(4)28(34)37-26/h13,16,19,21H,7-12,14-15H2,1-6H3,(H,30,33)(H,31,32) |
| InChIKey | VTQSQODRLZIUIF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|