C28H31NO6 — CID 4968055
2-[(2,2-dimethyl-6-oxo-3,4,7,8,9,10-hexahydroisochromeno[3,4-f]chromen-11-yl)oxy]-N-(2-hydroxy-2-phenylethyl)acetamide (PubChem CID 4968055) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-6-oxo-3,4,7,8,9,10-hexahydroisochromeno[3,4-f]chromen-11-yl)oxy]-N-(2-hydroxy-2-phenylethyl)acetamide.
| Compound Name | 2-[(2,2-dimethyl-6-oxo-3,4,7,8,9,10-hexahydroisochromeno[3,4-f]chromen-11-yl)oxy]-N-(2-hydroxy-2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4968055 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-[(2,2-dimethyl-6-oxo-3,4,7,8,9,10-hexahydroisochromeno[3,4-f]chromen-11-yl)oxy]-N-(2-hydroxy-2-phenylethyl)acetamide |
| SMILES | CC1(C)CCc2c(cc(OCC(=O)NCC(O)c3ccccc3)c3c4c(c(=O)oc23)CCCC4)O1 |
| InChI | InChI=1S/C28H31NO6/c1-28(2)13-12-20-22(35-28)14-23(25-18-10-6-7-11-19(18)27(32)34-26(20)25)33-16-24(31)29-15-21(30)17-8-4-3-5-9-17/h3-5,8-9,14,21,30H,6-7,10-13,15-16H2,1-2H3,(H,29,31) |
| InChIKey | ZDAFHRRAKCHIIS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|