C24H33N2O5+ — CID 7096756
3-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]propyl-dimethylazanium (PubChem CID 7096756) has the molecular formula C24H33N2O5+ and a molecular weight of 429.54 g/mol. Its IUPAC name is 3-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7096756 |
| Molecular Formula | C24H33N2O5+ |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-[[2-[(5,5-dimethyl-16-oxo-6,17-dioxatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-9-yl)oxy]acetyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)COc1cc2c(c3oc(=O)c4c(c13)CCC4)CCC(C)(C)O2 |
| InChI | InChI=1S/C24H32N2O5/c1-24(2)10-9-17-18(31-24)13-19(29-14-20(27)25-11-6-12-26(3)4)21-15-7-5-8-16(15)23(28)30-22(17)21/h13H,5-12,14H2,1-4H3,(H,25,27)/p+1 |
| InChIKey | GMJGALLMKNTWLW-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|