C18H28N4O — CID 96548969
(6S)-N-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-azaspiro[5.5]undec-9-ene-2-carboxamide (PubChem CID 96548969) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (6S)-N-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-azaspiro[5.5]undec-9-ene-2-carboxamide.
| Compound Name | (6S)-N-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-azaspiro[5.5]undec-9-ene-2-carboxamide |
|---|---|
| PubChem CID | 96548969 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (6S)-N-[(1S)-1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-azaspiro[5.5]undec-9-ene-2-carboxamide |
| SMILES | Cc1nn(C)cc1[C@H](C)NC(=O)N1CCC[C@@]2(CC=CCC2)C1 |
| InChI | InChI=1S/C18H28N4O/c1-14(16-12-21(3)20-15(16)2)19-17(23)22-11-7-10-18(13-22)8-5-4-6-9-18/h4-5,12,14H,6-11,13H2,1-3H3,(H,19,23)/t14-,18-/m0/s1 |
| InChIKey | QTRBLQAQEKATLG-KSSFIOAISA-N |
| XLogP | 3.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|