C17H21FN2O3 — CID 96549673
methyl 3-[(4-cyano-2-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propanoate (PubChem CID 96549673) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is methyl 3-[(4-cyano-2-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propanoate.
| Compound Name | methyl 3-[(4-cyano-2-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propanoate |
|---|---|
| PubChem CID | 96549673 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl 3-[(4-cyano-2-fluorophenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccc(C#N)cc1F)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H21FN2O3/c1-22-17(21)6-7-20(12-15-3-2-8-23-15)11-14-5-4-13(10-19)9-16(14)18/h4-5,9,15H,2-3,6-8,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | JPKKESKRTXOJEE-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |