C17H22N2O3 — CID 56790959
methyl 3-[(4-cyanophenyl)methyl-(oxolan-2-ylmethyl)amino]propanoate (PubChem CID 56790959) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 3-[(4-cyanophenyl)methyl-(oxolan-2-ylmethyl)amino]propanoate.
| Compound Name | methyl 3-[(4-cyanophenyl)methyl-(oxolan-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 56790959 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 3-[(4-cyanophenyl)methyl-(oxolan-2-ylmethyl)amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccc(C#N)cc1)CC1CCCO1 |
| InChI | InChI=1S/C17H22N2O3/c1-21-17(20)8-9-19(13-16-3-2-10-22-16)12-15-6-4-14(11-18)5-7-15/h4-7,16H,2-3,8-10,12-13H2,1H3 |
| InChIKey | PMYSQYQQXZNBQF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |