C20H21IN2O — CID 23961393
4-[[(3-iodophenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]benzonitrile (PubChem CID 23961393) has the molecular formula C20H21IN2O and a molecular weight of 432.31 g/mol. Its IUPAC name is 4-[[(3-iodophenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(3-iodophenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 23961393 |
| Molecular Formula | C20H21IN2O |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-[[(3-iodophenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN(Cc2cccc(I)c2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C20H21IN2O/c21-19-4-1-3-18(11-19)14-23(15-20-5-2-10-24-20)13-17-8-6-16(12-22)7-9-17/h1,3-4,6-9,11,20H,2,5,10,13-15H2 |
| InChIKey | CDHYCSBAAYXIDV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|