C20H33N3O2 — CID 96551104
3-(dimethylamino)-N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]benzamide (PubChem CID 96551104) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 96551104 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 3-(dimethylamino)-N-[(3R,4R)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]benzamide |
| SMILES | CCOCCCN1CC[C@@H](NC(=O)c2cccc(N(C)C)c2)[C@H](C)C1 |
| InChI | InChI=1S/C20H33N3O2/c1-5-25-13-7-11-23-12-10-19(16(2)15-23)21-20(24)17-8-6-9-18(14-17)22(3)4/h6,8-9,14,16,19H,5,7,10-13,15H2,1-4H3,(H,21,24)/t16-,19-/m1/s1 |
| InChIKey | MRZNTBPLLSWREB-VQIMIIECSA-N |
| XLogP | 2.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|