C6H8ClN3OS — CID 96555785
6-chloro-N-methyl-2-[(S)-methylsulfinyl]pyrimidin-4-amine (PubChem CID 96555785) has the molecular formula C6H8ClN3OS and a molecular weight of 205.67 g/mol. Its IUPAC name is 6-chloro-N-methyl-2-[(S)-methylsulfinyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-methyl-2-[(S)-methylsulfinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 96555785 |
| Molecular Formula | C6H8ClN3OS |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 6-chloro-N-methyl-2-[(S)-methylsulfinyl]pyrimidin-4-amine |
| SMILES | CNc1cc(Cl)nc([S@](C)=O)n1 |
| InChI | InChI=1S/C6H8ClN3OS/c1-8-5-3-4(7)9-6(10-5)12(2)11/h3H,1-2H3,(H,8,9,10)/t12-/m0/s1 |
| InChIKey | YZPNVDZULLTKDA-LBPRGKRZSA-N |
| XLogP | 0.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |