C22H23N3OS — CID 96557622
6-(4-methylsulfanylphenyl)-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]pyridazin-3-one (PubChem CID 96557622) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 6-(4-methylsulfanylphenyl)-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]pyridazin-3-one.
| Compound Name | 6-(4-methylsulfanylphenyl)-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 96557622 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 6-(4-methylsulfanylphenyl)-2-[[(3R)-3-phenylpyrrolidin-1-yl]methyl]pyridazin-3-one |
| SMILES | CSc1ccc(-c2ccc(=O)n(CN3CC[C@H](c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C22H23N3OS/c1-27-20-9-7-18(8-10-20)21-11-12-22(26)25(23-21)16-24-14-13-19(15-24)17-5-3-2-4-6-17/h2-12,19H,13-16H2,1H3/t19-/m0/s1 |
| InChIKey | SNFQZWRZBZVBRL-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |