C21H25FN2O2 — CID 96559160
N-[(2S,4R)-1-benzyl-2-methylpiperidin-4-yl]-2-(4-fluorophenoxy)acetamide (PubChem CID 96559160) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[(2S,4R)-1-benzyl-2-methylpiperidin-4-yl]-2-(4-fluorophenoxy)acetamide.
| Compound Name | N-[(2S,4R)-1-benzyl-2-methylpiperidin-4-yl]-2-(4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 96559160 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[(2S,4R)-1-benzyl-2-methylpiperidin-4-yl]-2-(4-fluorophenoxy)acetamide |
| SMILES | C[C@H]1C[C@H](NC(=O)COc2ccc(F)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C21H25FN2O2/c1-16-13-19(11-12-24(16)14-17-5-3-2-4-6-17)23-21(25)15-26-20-9-7-18(22)8-10-20/h2-10,16,19H,11-15H2,1H3,(H,23,25)/t16-,19+/m0/s1 |
| InChIKey | XASJHNRRHAATNU-QFBILLFUSA-N |
| XLogP | 3.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |