C17H15Cl2NO — CID 96564457
cis-(1R,2S)-N-benzyl-2-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 96564457) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is cis-(1R,2S)-N-benzyl-2-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-benzyl-2-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 96564457 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | cis-(1R,2S)-N-benzyl-2-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1C[C@@H]1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO/c18-13-6-12(7-14(19)8-13)15-9-16(15)17(21)20-10-11-4-2-1-3-5-11/h1-8,15-16H,9-10H2,(H,20,21)/t15-,16-/m1/s1 |
| InChIKey | VRNGUAWVAIAHOW-HZPDHXFCSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |