C13H22N2O3S — CID 96565229
(1R,6S)-N-piperidin-1-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 96565229) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is (1R,6S)-N-piperidin-1-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6S)-N-piperidin-1-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 96565229 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1R,6S)-N-piperidin-1-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(NS(=O)(=O)N1CCCCC1)C1[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H22N2O3S/c16-13(12-10-6-2-3-7-11(10)12)14-19(17,18)15-8-4-1-5-9-15/h10-12H,1-9H2,(H,14,16)/t10-,11+,12? |
| InChIKey | ZNMPQRCBAWYYCR-FOSCPWQOSA-N |
| XLogP | 1.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |