C13H21F3N2O3S — CID 71937981
N-piperidin-1-ylsulfonyl-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 71937981) has the molecular formula C13H21F3N2O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-piperidin-1-ylsulfonyl-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-piperidin-1-ylsulfonyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71937981 |
| Molecular Formula | C13H21F3N2O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-piperidin-1-ylsulfonyl-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)N1CCCCC1)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O3S/c14-13(15,16)11-7-3-2-6-10(11)12(19)17-22(20,21)18-8-4-1-5-9-18/h10-11H,1-9H2,(H,17,19) |
| InChIKey | YAXCHNSTEQVJLO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |