C14H22F3NO — CID 115583695
azepan-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 115583695) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is azepan-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | azepan-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 115583695 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | azepan-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | O=C(C1CCCCC1C(F)(F)F)N1CCCCCC1 |
| InChI | InChI=1S/C14H22F3NO/c15-14(16,17)12-8-4-3-7-11(12)13(19)18-9-5-1-2-6-10-18/h11-12H,1-10H2 |
| InChIKey | JKZRGMCMEYEOMC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |