C12H20ClF3N2O — CID 119402656
piperazin-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone;hydrochloride (PubChem CID 119402656) has the molecular formula C12H20ClF3N2O and a molecular weight of 300.75 g/mol. Its IUPAC name is piperazin-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone;hydrochloride.
| Compound Name | piperazin-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119402656 |
| Molecular Formula | C12H20ClF3N2O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | piperazin-1-yl-[2-(trifluoromethyl)cyclohexyl]methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCCC1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C12H19F3N2O.ClH/c13-12(14,15)10-4-2-1-3-9(10)11(18)17-7-5-16-6-8-17;/h9-10,16H,1-8H2;1H |
| InChIKey | BQIFEBWUNDRKIF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |