C13H19F3N2O3 — CID 107323011
3-amino-1-[2-(trifluoromethyl)cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 107323011) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-amino-1-[2-(trifluoromethyl)cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[2-(trifluoromethyl)cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107323011 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-amino-1-[2-(trifluoromethyl)cyclohexanecarbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(C(=O)C2CCCCC2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H19F3N2O3/c14-13(15,16)9-4-2-1-3-8(9)10(19)18-6-5-12(17,7-18)11(20)21/h8-9H,1-7,17H2,(H,20,21) |
| InChIKey | BEXRUZRLOOJPDB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |