C13H18F3NO2 — CID 113343194
1-[2-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-one (PubChem CID 113343194) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-one.
| Compound Name | 1-[2-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-one |
|---|---|
| PubChem CID | 113343194 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-[2-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)C2CCCCC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F3NO2/c14-13(15,16)11-4-2-1-3-10(11)12(19)17-7-5-9(18)6-8-17/h10-11H,1-8H2 |
| InChIKey | NFRVZCPKAKXCSI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |