C16H27F3N2O — CID 119647074
[4-(ethylaminomethyl)piperidin-1-yl]-[2-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 119647074) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is [4-(ethylaminomethyl)piperidin-1-yl]-[2-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | [4-(ethylaminomethyl)piperidin-1-yl]-[2-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 119647074 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | [4-(ethylaminomethyl)piperidin-1-yl]-[2-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | CCNCC1CCN(C(=O)C2CCCCC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H27F3N2O/c1-2-20-11-12-7-9-21(10-8-12)15(22)13-5-3-4-6-14(13)16(17,18)19/h12-14,20H,2-11H2,1H3 |
| InChIKey | HPUQEJHOEVTCMC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |