About [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate
[(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate (PubChem CID 96565280) has the molecular formula C11H10BrNO5
and a molecular weight of 316.11 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate.
Molecular Properties
| Compound Name | [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate |
| PubChem CID | 96565280 |
| Molecular Formula | C11H10BrNO5 |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate |
| SMILES | O=C(O[C@H]1CCOC1)c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10BrNO5/c12-7-1-2-9(10(5-7)13(15)16)11(14)18-8-3-4-17-6-8/h1-2,5,8H,3-4,6H2/t8-/m0/s1 |
| InChIKey | AOMAXKPYTKGANT-QMMMGPOBSA-N |
| XLogP | 2.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate?
The IUPAC name of [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate (CID 96565280) is [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate.
What is the SMILES notation for [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate?
The canonical SMILES for [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate is O=C(O[C@H]1CCOC1)c1ccc(Br)cc1[N+](=O)[O-].
What is the InChIKey of [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate?
The InChIKey is AOMAXKPYTKGANT-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H10BrNO5/c12-7-1-2-9(10(5-7)13(15)16)11(14)18-8-3-4-17-6-8/h1-2,5,8H,3-4,6H2/t8-/m0/s1.
What are the key properties of [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate?
[(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate has a molecular weight of 316.11 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxolan-3-yl] 4-bromo-2-nitrobenzoate is sourced from PubChem (CID 96565280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).