C16H22ClNO3 — CID 96568375
(3-chloro-4-methylphenyl)-[(3R)-3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 96568375) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-[(3R)-3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-chloro-4-methylphenyl)-[(3R)-3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 96568375 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3-chloro-4-methylphenyl)-[(3R)-3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COCCOC[C@@H]1CCN(C(=O)c2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClNO3/c1-12-3-4-14(9-15(12)17)16(19)18-6-5-13(10-18)11-21-8-7-20-2/h3-4,9,13H,5-8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | NXYGKAMPNSOXFU-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|