C12H14ClN5O2 — CID 96568608
N-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 96568608) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is N-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 96568608 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | CO[C@@H](CNC(=O)Cn1cnnn1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN5O2/c1-20-11(9-3-2-4-10(13)5-9)6-14-12(19)7-18-8-15-16-17-18/h2-5,8,11H,6-7H2,1H3,(H,14,19)/t11-/m0/s1 |
| InChIKey | OIYWTPMENAAHMS-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |