C12H13N5O3 — CID 62883661
2-phenyl-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid (PubChem CID 62883661) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-phenyl-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-phenyl-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 62883661 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-phenyl-3-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(Cn1cnnn1)NCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H13N5O3/c18-11(7-17-8-14-15-16-17)13-6-10(12(19)20)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,13,18)(H,19,20) |
| InChIKey | JRZCDVZSKGVVTR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |