C18H23FN2O — CID 96571910
[(1S)-cyclohex-3-en-1-yl]-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 96571910) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is [(1S)-cyclohex-3-en-1-yl]-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [(1S)-cyclohex-3-en-1-yl]-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 96571910 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [(1S)-cyclohex-3-en-1-yl]-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H23FN2O/c19-16-7-9-17(10-8-16)20-11-4-12-21(14-13-20)18(22)15-5-2-1-3-6-15/h1-2,7-10,15H,3-6,11-14H2/t15-/m1/s1 |
| InChIKey | IIFPQXBVZACXDI-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|