C18H22FNO3S — CID 99882951
[(1S)-cyclohex-3-en-1-yl]-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone (PubChem CID 99882951) has the molecular formula C18H22FNO3S and a molecular weight of 351.44 g/mol. Its IUPAC name is [(1S)-cyclohex-3-en-1-yl]-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone.
| Compound Name | [(1S)-cyclohex-3-en-1-yl]-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 99882951 |
| Molecular Formula | C18H22FNO3S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [(1S)-cyclohex-3-en-1-yl]-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCC[C@H](S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22FNO3S/c19-15-8-10-16(11-9-15)24(22,23)17-7-4-12-20(13-17)18(21)14-5-2-1-3-6-14/h1-2,8-11,14,17H,3-7,12-13H2/t14-,17+/m1/s1 |
| InChIKey | OJWTZSZIDHNDPY-PBHICJAKSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|