C17H23FN2O4S2 — CID 134374160
[3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methyl-1-nitrosothian-4-yl)methanone (PubChem CID 134374160) has the molecular formula C17H23FN2O4S2 and a molecular weight of 402.51 g/mol. Its IUPAC name is [3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methyl-1-nitrosothian-4-yl)methanone.
| Compound Name | [3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methyl-1-nitrosothian-4-yl)methanone |
|---|---|
| PubChem CID | 134374160 |
| Molecular Formula | C17H23FN2O4S2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]-(1-methyl-1-nitrosothian-4-yl)methanone |
| SMILES | CS1(N=O)CCC(C(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C17H23FN2O4S2/c1-25(19-22)10-7-13(8-11-25)17(21)20-9-6-16(12-20)26(23,24)15-4-2-14(18)3-5-15/h2-5,13,16H,6-12H2,1H3 |
| InChIKey | XLSPPWNUKFGCCL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |