C20H24N4O — CID 96572403
1H-indol-6-yl-[(2R)-2-[2-(2-methylimidazol-1-yl)ethyl]piperidin-1-yl]methanone (PubChem CID 96572403) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1H-indol-6-yl-[(2R)-2-[2-(2-methylimidazol-1-yl)ethyl]piperidin-1-yl]methanone.
| Compound Name | 1H-indol-6-yl-[(2R)-2-[2-(2-methylimidazol-1-yl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 96572403 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1H-indol-6-yl-[(2R)-2-[2-(2-methylimidazol-1-yl)ethyl]piperidin-1-yl]methanone |
| SMILES | Cc1nccn1CC[C@H]1CCCCN1C(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C20H24N4O/c1-15-21-10-13-23(15)12-8-18-4-2-3-11-24(18)20(25)17-6-5-16-7-9-22-19(16)14-17/h5-7,9-10,13-14,18,22H,2-4,8,11-12H2,1H3/t18-/m1/s1 |
| InChIKey | DURQZZCWEDYWBF-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |