C18H24ClN3O — CID 96574228
(2R)-1-(azepan-1-yl)-3-[2-(4-chlorophenyl)imidazol-1-yl]propan-2-ol (PubChem CID 96574228) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-3-[2-(4-chlorophenyl)imidazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(azepan-1-yl)-3-[2-(4-chlorophenyl)imidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 96574228 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-3-[2-(4-chlorophenyl)imidazol-1-yl]propan-2-ol |
| SMILES | O[C@H](CN1CCCCCC1)Cn1ccnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3O/c19-16-7-5-15(6-8-16)18-20-9-12-22(18)14-17(23)13-21-10-3-1-2-4-11-21/h5-9,12,17,23H,1-4,10-11,13-14H2/t17-/m1/s1 |
| InChIKey | UWVFRPSRSZJJGP-QGZVFWFLSA-N |
| XLogP | 3.44 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |