C19H32N2O2 — CID 96576991
(1-tert-butylpyrrol-3-yl)-[4-[(1S)-1-hydroxy-3-methylbutyl]piperidin-1-yl]methanone (PubChem CID 96576991) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (1-tert-butylpyrrol-3-yl)-[4-[(1S)-1-hydroxy-3-methylbutyl]piperidin-1-yl]methanone.
| Compound Name | (1-tert-butylpyrrol-3-yl)-[4-[(1S)-1-hydroxy-3-methylbutyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 96576991 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (1-tert-butylpyrrol-3-yl)-[4-[(1S)-1-hydroxy-3-methylbutyl]piperidin-1-yl]methanone |
| SMILES | CC(C)C[C@H](O)C1CCN(C(=O)c2ccn(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C19H32N2O2/c1-14(2)12-17(22)15-6-9-20(10-7-15)18(23)16-8-11-21(13-16)19(3,4)5/h8,11,13-15,17,22H,6-7,9-10,12H2,1-5H3/t17-/m0/s1 |
| InChIKey | KYVOSWUSEKELCI-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |