C17H27N3O3 — CID 110699015
ethyl 4-[(1-tert-butylpyrrole-3-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 110699015) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl 4-[(1-tert-butylpyrrole-3-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(1-tert-butylpyrrole-3-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110699015 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | ethyl 4-[(1-tert-butylpyrrole-3-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccn(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-5-23-16(22)19-9-7-14(8-10-19)18-15(21)13-6-11-20(12-13)17(2,3)4/h6,11-12,14H,5,7-10H2,1-4H3,(H,18,21) |
| InChIKey | UVRUSTUNQOIDFU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |