C11H14N4S — CID 96596567
2-(3-methyl-5-thia-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-10-yl)ethanamine (PubChem CID 96596567) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 2-(3-methyl-5-thia-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-10-yl)ethanamine.
| Compound Name | 2-(3-methyl-5-thia-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-10-yl)ethanamine |
|---|---|
| PubChem CID | 96596567 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(3-methyl-5-thia-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-10-yl)ethanamine |
| SMILES | Cc1nsc2c1-c1cnc(CCN)n1CC2 |
| InChI | InChI=1S/C11H14N4S/c1-7-11-8-6-13-10(2-4-12)15(8)5-3-9(11)16-14-7/h6H,2-5,12H2,1H3 |
| InChIKey | LWJCMOXIAKITSE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |