About 6-piperidin-4-ylthieno[2,3-d]pyrimidine
6-piperidin-4-ylthieno[2,3-d]pyrimidine (PubChem CID 96608942) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-piperidin-4-ylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-piperidin-4-ylthieno[2,3-d]pyrimidine |
| PubChem CID | 96608942 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-piperidin-4-ylthieno[2,3-d]pyrimidine |
| SMILES | c1ncc2cc(C3CCNCC3)sc2n1 |
| InChI | InChI=1S/C11H13N3S/c1-3-12-4-2-8(1)10-5-9-6-13-7-14-11(9)15-10/h5-8,12H,1-4H2 |
| InChIKey | OUSQCMWGVMTHMO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperidin-4-ylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-ylthieno[2,3-d]pyrimidine?
The IUPAC name of 6-piperidin-4-ylthieno[2,3-d]pyrimidine (CID 96608942) is 6-piperidin-4-ylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 6-piperidin-4-ylthieno[2,3-d]pyrimidine?
The canonical SMILES for 6-piperidin-4-ylthieno[2,3-d]pyrimidine is c1ncc2cc(C3CCNCC3)sc2n1.
What is the InChIKey of 6-piperidin-4-ylthieno[2,3-d]pyrimidine?
The InChIKey is OUSQCMWGVMTHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c1-3-12-4-2-8(1)10-5-9-6-13-7-14-11(9)15-10/h5-8,12H,1-4H2.
What are the key properties of 6-piperidin-4-ylthieno[2,3-d]pyrimidine?
6-piperidin-4-ylthieno[2,3-d]pyrimidine has a molecular weight of 219.31 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-ylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 96608942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).