C11H13N3S — CID 96608942
6-piperidin-4-ylthieno[2,3-d]pyrimidine (PubChem CID 96608942) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-piperidin-4-ylthieno[2,3-d]pyrimidine.
| Compound Name | 6-piperidin-4-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 96608942 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-piperidin-4-ylthieno[2,3-d]pyrimidine |
| SMILES | c1ncc2cc(C3CCNCC3)sc2n1 |
| InChI | InChI=1S/C11H13N3S/c1-3-12-4-2-8(1)10-5-9-6-13-7-14-11(9)15-10/h5-8,12H,1-4H2 |
| InChIKey | OUSQCMWGVMTHMO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |