C13H20N2 — CID 96618250
[(2R,3R)-2-methyl-1-phenylpiperidin-3-yl]methanamine (PubChem CID 96618250) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [(2R,3R)-2-methyl-1-phenylpiperidin-3-yl]methanamine.
| Compound Name | [(2R,3R)-2-methyl-1-phenylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 96618250 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [(2R,3R)-2-methyl-1-phenylpiperidin-3-yl]methanamine |
| SMILES | C[C@@H]1[C@@H](CN)CCCN1c1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-11-12(10-14)6-5-9-15(11)13-7-3-2-4-8-13/h2-4,7-8,11-12H,5-6,9-10,14H2,1H3/t11-,12-/m1/s1 |
| InChIKey | MLAXNGUPCAPUNP-VXGBXAGGSA-N |
| XLogP | 2.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |