C12H13N3O2S — CID 96666425
methyl 3-[(2-amino-1,3-thiazol-4-yl)methylamino]benzoate (PubChem CID 96666425) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is methyl 3-[(2-amino-1,3-thiazol-4-yl)methylamino]benzoate.
| Compound Name | methyl 3-[(2-amino-1,3-thiazol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 96666425 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | methyl 3-[(2-amino-1,3-thiazol-4-yl)methylamino]benzoate |
| SMILES | COC(=O)c1cccc(NCc2csc(N)n2)c1 |
| InChI | InChI=1S/C12H13N3O2S/c1-17-11(16)8-3-2-4-9(5-8)14-6-10-7-18-12(13)15-10/h2-5,7,14H,6H2,1H3,(H2,13,15) |
| InChIKey | PZOLLABMHXZICU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |