C11H13N3OS — CID 82476196
4-[(2-methoxyanilino)methyl]-1,3-thiazol-2-amine (PubChem CID 82476196) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-[(2-methoxyanilino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(2-methoxyanilino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82476196 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-[(2-methoxyanilino)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1NCc1csc(N)n1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-10-5-3-2-4-9(10)13-6-8-7-16-11(12)14-8/h2-5,7,13H,6H2,1H3,(H2,12,14) |
| InChIKey | ADGOBJCWGQXFSX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |