About (7S)-7-pyrimidin-4-yl-1,4-oxazepane
(7S)-7-pyrimidin-4-yl-1,4-oxazepane (PubChem CID 96743058) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is (7S)-7-pyrimidin-4-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | (7S)-7-pyrimidin-4-yl-1,4-oxazepane |
| PubChem CID | 96743058 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (7S)-7-pyrimidin-4-yl-1,4-oxazepane |
| SMILES | c1cc([C@@H]2CCNCCO2)ncn1 |
| InChI | InChI=1S/C9H13N3O/c1-3-11-7-12-8(1)9-2-4-10-5-6-13-9/h1,3,7,9-10H,2,4-6H2/t9-/m0/s1 |
| InChIKey | VQEWAIWIYGHBKP-VIFPVBQESA-N |
| XLogP | 0.53 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7S)-7-pyrimidin-4-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-pyrimidin-4-yl-1,4-oxazepane?
The IUPAC name of (7S)-7-pyrimidin-4-yl-1,4-oxazepane (CID 96743058) is (7S)-7-pyrimidin-4-yl-1,4-oxazepane.
What is the SMILES notation for (7S)-7-pyrimidin-4-yl-1,4-oxazepane?
The canonical SMILES for (7S)-7-pyrimidin-4-yl-1,4-oxazepane is c1cc([C@@H]2CCNCCO2)ncn1.
What is the InChIKey of (7S)-7-pyrimidin-4-yl-1,4-oxazepane?
The InChIKey is VQEWAIWIYGHBKP-VIFPVBQESA-N. The full InChI is InChI=1S/C9H13N3O/c1-3-11-7-12-8(1)9-2-4-10-5-6-13-9/h1,3,7,9-10H,2,4-6H2/t9-/m0/s1.
What are the key properties of (7S)-7-pyrimidin-4-yl-1,4-oxazepane?
(7S)-7-pyrimidin-4-yl-1,4-oxazepane has a molecular weight of 179.22 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-pyrimidin-4-yl-1,4-oxazepane is sourced from PubChem (CID 96743058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).