C15H19F2NO3S — CID 96801144
N-[(1S)-1-cyclopropylethyl]-4-(difluoromethylsulfonylmethyl)-N-methylbenzamide (PubChem CID 96801144) has the molecular formula C15H19F2NO3S and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropylethyl]-4-(difluoromethylsulfonylmethyl)-N-methylbenzamide.
| Compound Name | N-[(1S)-1-cyclopropylethyl]-4-(difluoromethylsulfonylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 96801144 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[(1S)-1-cyclopropylethyl]-4-(difluoromethylsulfonylmethyl)-N-methylbenzamide |
| SMILES | C[C@@H](C1CC1)N(C)C(=O)c1ccc(CS(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H19F2NO3S/c1-10(12-7-8-12)18(2)14(19)13-5-3-11(4-6-13)9-22(20,21)15(16)17/h3-6,10,12,15H,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | QLEWPXOERVZMRW-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |