C14H23N3O2 — CID 96834732
1-[2-[(1R,3R)-3-methylcyclohexyl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea (PubChem CID 96834732) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[2-[(1R,3R)-3-methylcyclohexyl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea.
| Compound Name | 1-[2-[(1R,3R)-3-methylcyclohexyl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 96834732 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-[2-[(1R,3R)-3-methylcyclohexyl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea |
| SMILES | C[C@@H]1CCC[C@@H](CCNC(=O)NCc2ccon2)C1 |
| InChI | InChI=1S/C14H23N3O2/c1-11-3-2-4-12(9-11)5-7-15-14(18)16-10-13-6-8-19-17-13/h6,8,11-12H,2-5,7,9-10H2,1H3,(H2,15,16,18)/t11-,12+/m1/s1 |
| InChIKey | UQEGPVCSDURHET-NEPJUHHUSA-N |
| XLogP | 2.69 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |