C9H16N4 — CID 96902609
(2S)-2-methyl-1-(5-methyl-1H-pyrazol-3-yl)piperazine (PubChem CID 96902609) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2S)-2-methyl-1-(5-methyl-1H-pyrazol-3-yl)piperazine.
| Compound Name | (2S)-2-methyl-1-(5-methyl-1H-pyrazol-3-yl)piperazine |
|---|---|
| PubChem CID | 96902609 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (2S)-2-methyl-1-(5-methyl-1H-pyrazol-3-yl)piperazine |
| SMILES | Cc1cc(N2CCNC[C@@H]2C)n[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-7-5-9(12-11-7)13-4-3-10-6-8(13)2/h5,8,10H,3-4,6H2,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | GTIPCWVNQJGOIA-QMMMGPOBSA-N |
| XLogP | 0.52 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |