C16H26N2O2S2 — CID 96979438
1-[(1R,2S)-2-[(S)-ethylsulfinyl]cyclohexyl]-3-[(1S)-1-thiophen-2-ylpropyl]urea (PubChem CID 96979438) has the molecular formula C16H26N2O2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(S)-ethylsulfinyl]cyclohexyl]-3-[(1S)-1-thiophen-2-ylpropyl]urea.
| Compound Name | 1-[(1R,2S)-2-[(S)-ethylsulfinyl]cyclohexyl]-3-[(1S)-1-thiophen-2-ylpropyl]urea |
|---|---|
| PubChem CID | 96979438 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[(1R,2S)-2-[(S)-ethylsulfinyl]cyclohexyl]-3-[(1S)-1-thiophen-2-ylpropyl]urea |
| SMILES | CC[C@H](NC(=O)N[C@@H]1CCCC[C@@H]1[S@@](=O)CC)c1cccs1 |
| InChI | InChI=1S/C16H26N2O2S2/c1-3-12(14-9-7-11-21-14)17-16(19)18-13-8-5-6-10-15(13)22(20)4-2/h7,9,11-13,15H,3-6,8,10H2,1-2H3,(H2,17,18,19)/t12-,13+,15-,22-/m0/s1 |
| InChIKey | NOLJMTBELAASCU-VQOAGZRVSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |