C15H18N2O3 — CID 96997193
(2R,3R)-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methyloxolane-2-carboxamide (PubChem CID 96997193) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2R,3R)-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methyloxolane-2-carboxamide.
| Compound Name | (2R,3R)-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 96997193 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2R,3R)-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methyloxolane-2-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)[C@@H]3OCC[C@H]3C)ccc2o1 |
| InChI | InChI=1S/C15H18N2O3/c1-3-13-17-11-8-10(4-5-12(11)20-13)16-15(18)14-9(2)6-7-19-14/h4-5,8-9,14H,3,6-7H2,1-2H3,(H,16,18)/t9-,14-/m1/s1 |
| InChIKey | AOQOYXJUFQGLSY-YMTOWFKASA-N |
| XLogP | 2.75 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |