C19H21N3O2S — CID 127934447
N-(2-ethyl-1,3-benzoxazol-5-yl)-4-thiophen-3-ylpiperidine-1-carboxamide (PubChem CID 127934447) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(2-ethyl-1,3-benzoxazol-5-yl)-4-thiophen-3-ylpiperidine-1-carboxamide.
| Compound Name | N-(2-ethyl-1,3-benzoxazol-5-yl)-4-thiophen-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 127934447 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(2-ethyl-1,3-benzoxazol-5-yl)-4-thiophen-3-ylpiperidine-1-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)N3CCC(c4ccsc4)CC3)ccc2o1 |
| InChI | InChI=1S/C19H21N3O2S/c1-2-18-21-16-11-15(3-4-17(16)24-18)20-19(23)22-8-5-13(6-9-22)14-7-10-25-12-14/h3-4,7,10-13H,2,5-6,8-9H2,1H3,(H,20,23) |
| InChIKey | YYLQFJYQQSCWKW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |