C17H20N4O2 — CID 96998789
N-[(3S)-1-methylpiperidin-3-yl]-N'-quinolin-8-yloxamide (PubChem CID 96998789) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(3S)-1-methylpiperidin-3-yl]-N'-quinolin-8-yloxamide.
| Compound Name | N-[(3S)-1-methylpiperidin-3-yl]-N'-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 96998789 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[(3S)-1-methylpiperidin-3-yl]-N'-quinolin-8-yloxamide |
| SMILES | CN1CCC[C@H](NC(=O)C(=O)Nc2cccc3cccnc23)C1 |
| InChI | InChI=1S/C17H20N4O2/c1-21-10-4-7-13(11-21)19-16(22)17(23)20-14-8-2-5-12-6-3-9-18-15(12)14/h2-3,5-6,8-9,13H,4,7,10-11H2,1H3,(H,19,22)(H,20,23)/t13-/m0/s1 |
| InChIKey | PWNHGEFYMBPYFP-ZDUSSCGKSA-N |
| XLogP | 1.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|