C20H21ClN2O3S — CID 96999705
methyl (2S)-2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-3-phenylpropanoate (PubChem CID 96999705) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is methyl (2S)-2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 96999705 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl (2S)-2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-3-phenylpropanoate |
| SMILES | COCCn1c(S[C@@H](Cc2ccccc2)C(=O)OC)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-25-11-10-23-17-9-8-15(21)13-16(17)22-20(23)27-18(19(24)26-2)12-14-6-4-3-5-7-14/h3-9,13,18H,10-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZWXKWXLWVFLQIJ-SFHVURJKSA-N |
| XLogP | 4.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |