About (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile
(2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile (PubChem CID 97001731) has the molecular formula C18H22ClN5
and a molecular weight of 343.86 g/mol. Its IUPAC name is (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile.
Molecular Properties
| Compound Name | (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile |
| PubChem CID | 97001731 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCN([C@H](C#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22ClN5/c1-14-16(18(19)22(2)21-14)13-23-8-10-24(11-9-23)17(12-20)15-6-4-3-5-7-15/h3-7,17H,8-11,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | CCBHOCYJTCUSFA-QGZVFWFLSA-N |
| XLogP | 2.76 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile?
The IUPAC name of (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile (CID 97001731) is (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile.
What is the SMILES notation for (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile?
The canonical SMILES for (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile is Cc1nn(C)c(Cl)c1CN1CCN([C@H](C#N)c2ccccc2)CC1.
What is the InChIKey of (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile?
The InChIKey is CCBHOCYJTCUSFA-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H22ClN5/c1-14-16(18(19)22(2)21-14)13-23-8-10-24(11-9-23)17(12-20)15-6-4-3-5-7-15/h3-7,17H,8-11,13H2,1-2H3/t17-/m1/s1.
What are the key properties of (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile?
(2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile has a molecular weight of 343.86 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-phenylacetonitrile is sourced from PubChem (CID 97001731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).