C16H18N2O6S2 — CID 97002285
2-methyl-N-[(1S)-2-methylsulfonyl-1-phenylethyl]-3-nitrobenzenesulfonamide (PubChem CID 97002285) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2-methylsulfonyl-1-phenylethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 2-methyl-N-[(1S)-2-methylsulfonyl-1-phenylethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 97002285 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-methyl-N-[(1S)-2-methylsulfonyl-1-phenylethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)N[C@H](CS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O6S2/c1-12-15(18(19)20)9-6-10-16(12)26(23,24)17-14(11-25(2,21)22)13-7-4-3-5-8-13/h3-10,14,17H,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | DOWLZVRUAUSYCU-CQSZACIVSA-N |
| XLogP | 1.97 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|