C20H28N4O — CID 97005705
(2R,3R)-N-(3-imidazol-1-ylpropyl)-3-methyl-2-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 97005705) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2R,3R)-N-(3-imidazol-1-ylpropyl)-3-methyl-2-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (2R,3R)-N-(3-imidazol-1-ylpropyl)-3-methyl-2-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97005705 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2R,3R)-N-(3-imidazol-1-ylpropyl)-3-methyl-2-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc([C@H]2[C@H](C)CCCN2C(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C20H28N4O/c1-16-6-8-18(9-7-16)19-17(2)5-3-13-24(19)20(25)22-10-4-12-23-14-11-21-15-23/h6-9,11,14-15,17,19H,3-5,10,12-13H2,1-2H3,(H,22,25)/t17-,19-/m1/s1 |
| InChIKey | GBCITEVTVQYJNI-IEBWSBKVSA-N |
| XLogP | 3.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|